Giận hờn chi em ơi

Sáng tác: Lê Lãng Du | Nhạc Trữ Tình | Điệu: Chưa chọn | Đức Duy | 135

b [Dm] #
Ẩn hợp âm

1. Hờn làm [F] chi em ơi giận làm [Gm7] chi em ơi
Cho dòng lệ [C] buồn rớt xuống nhạt [Am7] nhòa
Đời còn [Gm7] bao nhiêu đâu, để hồn [F] qua đêm sâu
Chìm trong nỗi [Csus4/C] sầu nhớ thương về [Dm7] đâu.

2. Buồn làm [F] chi em ơi lạnh lùng [Gm7] chi em ơi
Sao vì một [C] lời nói rất thật [Am7] lòng
Đời mình [Gm7] như rêu rong để rồi [F] đêm thương mong
Trầm trong cõi [Csus4/C] tình xót xa đời [Dm] nhau.

ĐK:
[F] Buồn làm chi [Dm] hỡi em [C] ơi
[Dm] Giận làm chi [C] hỡi em [Gm7] ơi
Em vui [Am] lên với [C] đời
Cho tin [Gm7] yêu sáng [C] ngời
Thiết tha hồn [Dm] hoa.

3. Rồi ngày [F] mai em vui nụ cười [Gm7] xinh trên môi
Tâm hồn dạt [C] dào luyến ái ngọt [Am7] ngào
Lòng người [Gm7] đơm lên hoa tuổi đời [F] thêm kiêu sa
Hồn dâng nỗi [Csus4/C] niềm dấu yêu về [Dm] nhau.

------------------------------

Tone ca sĩ:
- Đức Duy [Dm] 

Nhập bình luận

Hợp âm guitar sử dụng

Bài hát cùng thể loại
Nghe nói anh [Em] Ba xóm trên rất đa [A] tài Anh kéo đàn [Em] cò nghe ngọt sớt cái... 225
Mai em [Em] đi anh có đợi [Am] chờ Mai em [B7] đi anh có làm [Em] thơ Mai em [C]... 238
1. Một sớm sương [Em] mờ em về [C] quê qua [Bm] bến Bắc Cần [Em] Thơ Lối đi gió... 244
Sông [Dm] dài mấy nhánh phù [A] vân Mười hai bến [A7] nước một thân phận [Dm] người Tơ [D7] điều... 254
Intro & vòng hợp âm : [D][Bb][F][C]-[D][Bb][F][C]- * Diễm Sương: Nước [Dm] xanh, xanh, trời [Bb] xanh, xanh Nơi [F] đây hắt... 210
(st-79 Văn Vũ) 1. Tình [Am] lỡ đã trôi qua một dĩ vãng không nguôi [A7] Tình [Dm] hứa sẽ... 186
1. Ta trách cho chuyện [Dm] đời lọc lừa trên những bờ [F] môi Đời bao trái [Bb] ngang mới... 236
1. Chiều lạnh lùng tím ngắt nụ [F] cười [Gm] Xa vắng trên giòng sông cuốn trôi [Dm] Anh nhớ rồi... 280
[C] Em lo gì trời gió Em lo gì trời [G] mưa Em lo gì mùa [C] hè [G] Em tiếc gì... 240
Quê [Am] hương là gì? Quê [A7] hương là [Dm] gì? Chắc em [Em] biết nên tiếng hát buồn... 258
Bài hát cùng tác giả
1. Hờn làm [F] chi em ơi giận làm [Gm7] chi em ơi Cho dòng lệ [C] buồn rớt xuống... 135
Khi ngồi lại một [Em] mình Tìm lại nhật [Dm] trình Một thời khốn [Am7] khó Một thời gian [G7] nan Cách xa... 156
1. Đêm tràn [G] đêm đầy giấc mộng [Em] hồng Ru hồn [Am] trong nỗi nhớ mênh [G] mông Xin tìm... 141
Một [Am] lần tình cờ tôi [C] đến bên [Em] người Một [Dm] lời đầu tiên yêu [G] dấu trên... 159