Còn nhìn nhau hôm nay

Sáng tác: Lê Hựu Hà | Nhạc Vàng | Điệu: Chưa chọn | Elvis Phương | 189

b [C] #
Ẩn hợp âm

Intro: [F][C]-[F][C]-[F][C]-[F][C]

[C] Còn nhìn nhau hôm nay còn trông thấy
Trông [Dm] thấy nhau nghe lòng đã vui
[C] Từng niềm vui chia nhau từng giây phút
Giây [Dm] phút bên nhau lòng đã say

[C] Mai [Am] đời [Dm] cách [G] xa
[C] Mảnh [Am] tình [Dm] thiết [G] tha
Còn ôm [C] ấp muôn đời.

[F][C]-[F][C]-[F][C]

[C] Ngày và đêm quên đi thời gian nhé
Quên [Dm] cả không gian còn ngủ mê
[C] Để dù mai sương tan hồn băng giá
Hơi [Dm] ấm xa xưa còn bóng ma.

[C] Trong [Am] lòng, [Dm] đất [G] sâu
[C] Vẫn [Am] còn [Dm] nhớ [G] nhau
Đời đã [C] kết nhau rồi [F]

[Bb] Đã biết ngày tháng rồi sẽ [Am] qua
[Bb] Đã biết gần mãi rồi sẽ [Am] xa
Phút giây gần [G] nhau
Sống [F] lãng quên niềm [C] đau

[Bb] Đã biết ngày tháng rồi sẽ [Am] qua
[Bb] Đã biết gần mãi rồi sẽ [Am] xa
Phút giây gần [G] nhau
Sống [F] lãng quên niềm [C] đau


------------------------------

Tone ca sĩ:
- Elvis Phương [C] 

Nhập bình luận

Hợp âm guitar sử dụng

Bài hát cùng thể loại
1. Gió cuốn theo chiều [Dm] xuống qua bao đồi nương Nắng úa trên ngàn [F] lá khi ánh chiều... 324
1. Được tin em lấy [Dm] chồng,lòng anh buồn biết [F] mấy Được [D7] tin em lấy [Gm] chồng,chắc người... 352
1. Trời [A] khuya, quá canh [C#m] ba tiếng gà [E7] gáy vang thôn [A] nghèo Đìu [F#m] hiu ánh... 272
Em [G] ơi hôm nay anh thấy buồn Lanh [D7] lùng hơi gió buốt [G] sương Cô [Em] đơn là bầu... 283
1. Đã từ lâu ngược xuôi đó [E7] đây thân lính chiến đánh giặc đêm [Am] ngày Lưng bụi... 263
Đang lúc nửa [Am] đêm tôi đánh mất người yêu Có ai tìm [F] thấy nhớ xin mang trả [Am]... 262
1. Người [Dm] yêu em có [F] nghe, bờ [G] môi xanh xao [C] đầy Tìm [Dm] em, tìm [Bb]... 240
1. Chiều [Am] nay chuyến xe [E7] đi khi bóng ngả xế [Am] tà Nhịp [Dm] xe lướt nhanh nhanh... 329
1. Một [Em] đêm quay bước [D] đi xa thành [Em] đô buồn [B7] Mộng [Em] mơ nay đã [G]... 407
Từ thủa chào [Am] đời trong vành [C] nôi niềm thương mới [Am] ngỏ Nghe bùi [Dm] ngùi giọng hát... 214
Bài hát cùng tác giả
Đôi [D] khi ta muốn thoát ly Đi thật [G] xa khỏi khung trời [D] này Lên [C] rừng... 244
1. Hãy vui [D] lên bạn [Bm] ơi ! [G] Thời gian chẳng [D] cho ta một [F#m] giờ... 272
1. [G] Cười lên đi em [Gm7] ơi Dù nước [C] mắt rớt trên vành [Bm] môi [Em] Hãy ngước mặt... 235
Intro: [F][C]-[F][C]-[F][C]-[F][C] [C] Còn nhìn nhau hôm nay còn trông thấy Trông [Dm] thấy nhau nghe lòng đã vui [C] Từng niềm... 189
1.[D] Yêu em vì ta [Bm] ghét buồn [D] Yêu em vì ta [Bm] ghét hờn [G] Yêu em vì ta... 272
[Am] Đã nhiều lần muốn [G] nói nhưng thôi [Am] đành thôi Quyết rằng lòng nhất [G] định sẽ không... 250
1. Loài ngọc [C] đá mang tên [Dm] em Đã hơn mấy [Am] mùa gọt đau từng [C] phiến Loài hoa... 274
1. Bạn thân [C] ơi tôi muốn [Am] nói Rằng quanh [G] ta không ai lẻ [C] loi Hãy... 262
1. Một [C] nụ hoa trên mái [Am] tóc hững hờ Một [C] tình thương cho cuộc [Am] sống... 238
Nhìn lại sau [Em] lưng giờ đây Bóng [D] đêm dang rộng tay Đuổi [C] xua ta vào kiếp lưu [G]... 227